CAS 119916-22-2

2-METHYL-3,4,6-TRIFLUORO BENZOIC ACID

Description:

2-Methyl-3,4,6-trifluorobenzoic acid is an aromatic carboxylic acid characterized by the presence of a benzoic acid core substituted with three fluorine atoms and a methyl group. The fluorine substituents are located at the 3, 4, and 6 positions of the benzene ring, which significantly influences the compound's chemical properties, including its acidity and polarity. This compound is typically a solid at room temperature and exhibits high thermal stability due to the strong C-F bonds. Its fluorinated structure enhances lipophilicity and can affect solubility in various solvents. The presence of the carboxylic acid functional group imparts acidic properties, allowing it to participate in various chemical reactions, including esterification and amidation. Additionally, the trifluoromethyl groups can enhance biological activity, making this compound of interest in pharmaceutical and agrochemical research. Safety data should be consulted for handling, as fluorinated compounds can pose specific health and environmental risks.

Formula: C₈H₅F₃O₂

InChI: InChI=1/C8H5F3O2/c1-3-6(8(12)13)4(9)2-5(10)7(3)11/h2H,1H3,(H,12,13)

SMILES: Cc1c(c(cc(c1F)F)F)C(=O)O

Synonyms:

• 3-Methyl-2,4,5-trifluorobenzoyl chloride
• 3,4,6-Trifluoro-2-Methylbenzoic Acid

2-Methyl-3,4,6-trifluorobenzoic acid

CAS: 119916-22-2

Formula: C₈H₅F₃O₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 190.1193

Ref: IN-DA007QSJ

2-Methyl-3,4,6-trifluorobenzoic acid

CAS: 119916-22-2

2-Methyl-3,4,6-trifluorobenzoic acid

Purity: 95%

Molecular weight: 190.12g/mol

Ref: 54-PC902765

2-Methyl-3,4,6-trifluorobenzoic Acid

Controlled Product

CAS: 119916-22-2

Applications 2-Methyl-3,4,6-trifluorobenzoic Acid is an intermediate in the synthesis of dl-Grepafloxacin (G783000), which is an antibacterial compound used to treat various respirator infections.
References O'Shea, R. et al.: J. Med. Chem., 51, 2871 (2008); Zhanel, G. et al.: Drugs, 62, 13 (2002);

Formula: C₈H₅O₂F₃

Color and Shape: Neat

Molecular weight: 190.11

Ref: TR-M221093

2-Methyl-3,4,6-trifluorobenzoic acid

CAS: 119916-22-2

Formula: C₈H₅F₃O₂

Purity: 98%

Molecular weight: 190.121

Ref: 10-F225515