CAS 1199215-55-8

4-Amino-N-[(4-chlorophenyl)methyl]-N-methylbenzenesulfonamide

Description:

4-Amino-N-[(4-chlorophenyl)methyl]-N-methylbenzenesulfonamide, also known by its CAS number 1199215-55-8, is a sulfonamide compound characterized by the presence of an amino group and a sulfonamide functional group. This compound features a methyl group attached to the nitrogen atom of the sulfonamide, as well as a 4-chlorophenyl group linked through a methylene bridge. The sulfonamide moiety contributes to its potential biological activity, often associated with antibacterial properties. The presence of the chlorine atom on the phenyl ring can influence the compound's lipophilicity and biological interactions. Typically, sulfonamides exhibit moderate solubility in water and can participate in various chemical reactions, including nucleophilic substitutions. The compound's structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting bacterial infections or other therapeutic areas. However, specific properties such as melting point, boiling point, and solubility would require empirical data for precise characterization.

Formula: C₁₄H₁₅ClN₂O₂S

InChI: InChI=1S/C14H15ClN2O2S/c1-17(10-11-2-4-12(15)5-3-11)20(18,19)14-8-6-13(16)7-9-14/h2-9H,10,16H2,1H3

InChI key: InChIKey=USWNPQPIDCRLDB-UHFFFAOYSA-N

SMILES: S(N(CC1=CC=C(Cl)C=C1)C)(=O)(=O)C2=CC=C(N)C=C2

Synonyms:

• Benzenesulfonamide, 4-amino-N-[(4-chlorophenyl)methyl]-N-methyl-
• 4-Amino-N-[(4-chlorophenyl)methyl]-N-methylbenzenesulfonamide