CAS 1199215-65-0
:[4-(5-Amino-1,3,4-thiadiazol-2-yl)-1-piperidinyl]phenylmethanone
Description:
[4-(5-Amino-1,3,4-thiadiazol-2-yl)-1-piperidinyl]phenylmethanone, with the CAS number 1199215-65-0, is a chemical compound characterized by its complex structure that includes a piperidine ring and a thiadiazole moiety. This compound typically exhibits properties associated with both heterocyclic and aromatic systems, which may contribute to its potential biological activity. The presence of the amino group on the thiadiazole suggests possible interactions with biological targets, making it of interest in medicinal chemistry. The phenylmethanone part of the molecule indicates that it may possess ketone functionality, which can influence its reactivity and solubility. Such compounds are often investigated for their pharmacological properties, including antimicrobial or anticancer activities. Additionally, the structural features may allow for various modifications, enhancing its therapeutic potential. Overall, this compound represents a class of organic molecules that could be valuable in drug development and research applications.
Formula:C14H16N4OS
InChI:InChI=1S/C14H16N4OS/c15-14-17-16-12(20-14)10-6-8-18(9-7-10)13(19)11-4-2-1-3-5-11/h1-5,10H,6-9H2,(H2,15,17)
InChI key:InChIKey=VLWDJJICSZIPKM-UHFFFAOYSA-N
SMILES:NC=1SC(=NN1)C2CCN(C(=O)C3=CC=CC=C3)CC2
Synonyms:- [4-(5-Amino-1,3,4-thiadiazol-2-yl)-1-piperidinyl]phenylmethanone
- Methanone, [4-(5-amino-1,3,4-thiadiazol-2-yl)-1-piperidinyl]phenyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.