CAS 1199215-67-2
:2-(2,5-Difluorophenoxy)-4-pyridinecarboxylic acid
Description:
2-(2,5-Difluorophenoxy)-4-pyridinecarboxylic acid is a chemical compound characterized by its unique structure, which includes a pyridine ring and a phenoxy group substituted with two fluorine atoms. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as stability and potential reactivity due to the presence of functional groups. The difluorophenoxy moiety can influence its solubility and polarity, making it potentially useful in various applications, including pharmaceuticals and agrochemicals. The carboxylic acid functional group contributes to its acidity and can participate in hydrogen bonding, affecting its interactions with other molecules. Additionally, the presence of fluorine atoms often enhances the compound's lipophilicity and metabolic stability. Overall, 2-(2,5-Difluorophenoxy)-4-pyridinecarboxylic acid is a compound of interest in chemical research, particularly in the development of new materials or therapeutic agents.
Formula:C12H7F2NO3
InChI:InChI=1S/C12H7F2NO3/c13-8-1-2-9(14)10(6-8)18-11-5-7(12(16)17)3-4-15-11/h1-6H,(H,16,17)
InChI key:InChIKey=MSRGCSQKRRUWJH-UHFFFAOYSA-N
SMILES:O(C1=CC(C(O)=O)=CC=N1)C2=C(F)C=CC(F)=C2
Synonyms:- 4-Pyridinecarboxylic acid, 2-(2,5-difluorophenoxy)-
- 2-(2,5-Difluorophenoxy)-4-pyridinecarboxylic acid
- 2-(2,5-difluorophenoxy)isonicotinic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.