CAS 1199215-72-9

N-[2-(5-Amino-1,3,4-thiadiazol-2-yl)ethyl]-2-chlorobenzamide

Description:

N-[2-(5-Amino-1,3,4-thiadiazol-2-yl)ethyl]-2-chlorobenzamide is a chemical compound characterized by its unique structure, which includes a thiadiazole ring, an amine group, and a chlorobenzamide moiety. This compound features a thiadiazole, a five-membered heterocyclic ring containing sulfur and nitrogen, which contributes to its biological activity and potential pharmacological properties. The presence of the amino group enhances its reactivity and solubility in polar solvents, while the chlorobenzamide portion may influence its interaction with biological targets. The compound is likely to exhibit properties such as moderate to high polarity, potential for hydrogen bonding, and possible interactions with various biological systems, making it of interest in medicinal chemistry. Its specific applications may include roles in drug development or as a biochemical probe, although detailed studies would be necessary to elucidate its full range of characteristics and potential uses. As with many chemical substances, safety and handling precautions should be observed due to potential toxicity or reactivity.

Formula: C₁₁H₁₁ClN₄OS

InChI: InChI=1S/C11H11ClN4OS/c12-8-4-2-1-3-7(8)10(17)14-6-5-9-15-16-11(13)18-9/h1-4H,5-6H2,(H2,13,16)(H,14,17)

InChI key: InChIKey=WQUYYECWSUHRGZ-UHFFFAOYSA-N

SMILES: C(NCCC=1SC(N)=NN1)(=O)C2=C(Cl)C=CC=C2

Synonyms:

• N-[2-(5-Amino-1,3,4-thiadiazol-2-yl)ethyl]-2-chlorobenzamide
• Benzamide, N-[2-(5-amino-1,3,4-thiadiazol-2-yl)ethyl]-2-chloro-