CAS 1199215-83-2

N-[2-(5-Amino-1,3,4-thiadiazol-2-yl)ethyl]-4-nitrobenzenesulfonamide

Description:

N-[2-(5-Amino-1,3,4-thiadiazol-2-yl)ethyl]-4-nitrobenzenesulfonamide is a chemical compound characterized by its complex structure, which includes a thiadiazole ring, an amino group, and a sulfonamide moiety. The presence of the nitro group on the benzene ring contributes to its potential reactivity and biological activity. This compound is likely to exhibit polar characteristics due to the sulfonamide and amino functional groups, which can engage in hydrogen bonding. It may also possess antimicrobial properties, as many sulfonamides are known for their use in pharmaceuticals, particularly as antibiotics. The thiadiazole ring can enhance the compound's biological activity and may contribute to its pharmacological profile. Additionally, the compound's solubility and stability can be influenced by its functional groups, making it of interest in medicinal chemistry and drug development. Overall, this compound's unique structural features suggest potential applications in therapeutic contexts, although specific biological activities would require further investigation.

Formula: C₁₀H₁₁N₅O₄S₂

InChI: InChI=1S/C10H11N5O4S2/c11-10-14-13-9(20-10)5-6-12-21(18,19)8-3-1-7(2-4-8)15(16)17/h1-4,12H,5-6H2,(H2,11,14)

InChI key: InChIKey=AYFDUKOFPYEGIW-UHFFFAOYSA-N

SMILES: S(NCCC=1SC(N)=NN1)(=O)(=O)C2=CC=C(N(=O)=O)C=C2

Synonyms:

• Benzenesulfonamide, N-[2-(5-amino-1,3,4-thiadiazol-2-yl)ethyl]-4-nitro-
• N-[2-(5-Amino-1,3,4-thiadiazol-2-yl)ethyl]-4-nitrobenzenesulfonamide