CymitQuimica logo

CAS 1199215-86-5

:

1-[[1-(1,1-Dimethylethyl)-5-oxo-3-pyrrolidinyl]carbonyl]-4-piperidinecarboxylic acid

Description:
1-[[1-(1,1-Dimethylethyl)-5-oxo-3-pyrrolidinyl]carbonyl]-4-piperidinecarboxylic acid, identified by its CAS number 1199215-86-5, is a synthetic organic compound characterized by its complex structure, which includes a piperidine ring and a pyrrolidine moiety. This compound features a carboxylic acid functional group, contributing to its acidic properties, and a carbonyl group that plays a significant role in its reactivity and potential interactions with biological targets. The presence of the bulky tert-butyl group (1,1-dimethylethyl) enhances its lipophilicity, which may influence its pharmacokinetic properties. The compound's unique structural features suggest potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting specific biological pathways. Its synthesis and characterization would typically involve standard organic chemistry techniques, including NMR spectroscopy and mass spectrometry, to confirm its identity and purity. Overall, this compound represents a class of molecules that may exhibit interesting biological activities, warranting further investigation in drug discovery and development.
Formula:C15H24N2O4
InChI:InChI=1S/C15H24N2O4/c1-15(2,3)17-9-11(8-12(17)18)13(19)16-6-4-10(5-7-16)14(20)21/h10-11H,4-9H2,1-3H3,(H,20,21)
InChI key:InChIKey=FBGNNNVCJXWVHL-UHFFFAOYSA-N
SMILES:C(=O)(C1CN(C(C)(C)C)C(=O)C1)N2CCC(C(O)=O)CC2
Synonyms:
  • 4-Piperidinecarboxylic acid, 1-[[1-(1,1-dimethylethyl)-5-oxo-3-pyrrolidinyl]carbonyl]-
  • 1-[[1-(1,1-Dimethylethyl)-5-oxo-3-pyrrolidinyl]carbonyl]-4-piperidinecarboxylic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.