CAS 1199215-87-6
:N-[2-(5-Amino-1,3,4-thiadiazol-2-yl)ethyl]-4-bromobenzenesulfonamide
Description:
N-[2-(5-Amino-1,3,4-thiadiazol-2-yl)ethyl]-4-bromobenzenesulfonamide is a chemical compound characterized by its unique structure, which includes a thiadiazole ring and a sulfonamide functional group. The presence of the amino group on the thiadiazole contributes to its potential biological activity, making it of interest in pharmaceutical research. The bromobenzene moiety enhances its reactivity and may influence its interaction with biological targets. This compound is likely to exhibit properties typical of sulfonamides, such as antibacterial activity, although specific biological activities would depend on its precise molecular interactions. Its solubility, stability, and reactivity can vary based on environmental conditions and the presence of other chemical species. The CAS number 1199215-87-6 uniquely identifies this compound, facilitating its recognition in scientific literature and databases. Overall, this substance represents a class of compounds that may have applications in medicinal chemistry and drug development, particularly in targeting specific biological pathways.
Formula:C10H11BrN4O2S2
InChI:InChI=1S/C10H11BrN4O2S2/c11-7-1-3-8(4-2-7)19(16,17)13-6-5-9-14-15-10(12)18-9/h1-4,13H,5-6H2,(H2,12,15)
InChI key:InChIKey=MTIQWVSOLZVVLN-UHFFFAOYSA-N
SMILES:S(NCCC=1SC(N)=NN1)(=O)(=O)C2=CC=C(Br)C=C2
Synonyms:- N-[2-(5-Amino-1,3,4-thiadiazol-2-yl)ethyl]-4-bromobenzenesulfonamide
- Benzenesulfonamide, N-[2-(5-amino-1,3,4-thiadiazol-2-yl)ethyl]-4-bromo-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.