CAS 1199215-89-8

2-[4-(Cyanomethyl)phenoxy]-6-methyl-3-pyridinecarboxylic acid

Description:

2-[4-(Cyanomethyl)phenoxy]-6-methyl-3-pyridinecarboxylic acid, identified by its CAS number 1199215-89-8, is a chemical compound that features a complex structure comprising a pyridine ring, a carboxylic acid functional group, and a phenoxy moiety with a cyanomethyl substituent. This compound is characterized by its potential applications in pharmaceuticals and agrochemicals, owing to its unique functional groups that may exhibit biological activity. The presence of the cyanomethyl group suggests potential reactivity, while the carboxylic acid can participate in various chemical reactions, including esterification and amidation. Additionally, the compound's solubility and stability can be influenced by the presence of the pyridine and phenoxy groups, which may also affect its interaction with biological targets. Overall, this compound's structural features indicate that it may possess interesting properties for further research and development in medicinal chemistry or related fields.

Formula: C₁₅H₁₂N₂O₃

InChI: InChI=1S/C15H12N2O3/c1-10-2-7-13(15(18)19)14(17-10)20-12-5-3-11(4-6-12)8-9-16/h2-7H,8H2,1H3,(H,18,19)

InChI key: InChIKey=SWEOCMXUPJXANI-UHFFFAOYSA-N

SMILES: C(O)(=O)C1=C(OC2=CC=C(CC#N)C=C2)N=C(C)C=C1

Synonyms:

• 3-Pyridinecarboxylic acid, 2-[4-(cyanomethyl)phenoxy]-6-methyl-
• 2-[4-(Cyanomethyl)phenoxy]-6-methyl-3-pyridinecarboxylic acid