CAS 1199215-91-2
:Methyl 4-(1H-1,2,4-triazol-5-yl)benzoate
Description:
Methyl 4-(1H-1,2,4-triazol-5-yl)benzoate is an organic compound characterized by its triazole and benzoate functional groups. It features a methyl ester group attached to a benzoic acid derivative, with a 1H-1,2,4-triazole moiety substituent at the para position of the aromatic ring. This compound is typically a white to off-white solid, and its molecular structure contributes to its potential applications in pharmaceuticals, particularly as an antifungal agent due to the presence of the triazole ring, which is known for its ability to inhibit fungal cytochrome P450 enzymes. The compound's solubility and stability can vary depending on the solvent and environmental conditions, making it important for formulation considerations in various applications. Additionally, its synthesis often involves standard organic reactions such as esterification and substitution, highlighting its relevance in synthetic organic chemistry. Safety data should be consulted for handling and storage, as with any chemical substance.
Formula:C10H9N3O2
InChI:InChI=1S/C10H9N3O2/c1-15-10(14)8-4-2-7(3-5-8)9-11-6-12-13-9/h2-6H,1H3,(H,11,12,13)
InChI key:InChIKey=HBBMQBJFBRVVTI-UHFFFAOYSA-N
SMILES:C(OC)(=O)C1=CC=C(C=C1)C=2NC=NN2
Synonyms:- Benzoic acid, 4-(1H-1,2,4-triazol-5-yl)-, methyl ester
- Methyl 4-(1H-1,2,4-triazol-5-yl)benzoate
- benzoic acid, 4-(4H-1,2,4-triazol-3-yl)-, methyl ester
- methyl 4-(4H-1,2,4-triazol-3-yl)benzoate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
