CymitQuimica logo

CAS 1199215-92-3

:

2-(Imidazo[1,2-a]pyridin-3-ylmethyl)-1H-isoindole-1,3(2H)-dione

Description:
2-(Imidazo[1,2-a]pyridin-3-ylmethyl)-1H-isoindole-1,3(2H)-dione, with the CAS number 1199215-92-3, is a chemical compound characterized by its complex structure, which includes an isoindole moiety and an imidazo-pyridine group. This compound typically exhibits properties such as moderate solubility in organic solvents and potential bioactivity, making it of interest in medicinal chemistry. Its molecular framework suggests possible interactions with biological targets, which may lead to pharmacological applications. The presence of both nitrogen-containing heterocycles may contribute to its reactivity and ability to form hydrogen bonds, influencing its behavior in biological systems. Additionally, the compound may undergo various chemical transformations, including oxidation or substitution reactions, depending on the conditions. Overall, this substance represents a class of compounds that could be explored for their therapeutic potential, particularly in the context of drug discovery and development. Further studies would be necessary to elucidate its specific properties and biological activities.
Formula:C16H11N3O2
InChI:InChI=1S/C16H11N3O2/c20-15-12-5-1-2-6-13(12)16(21)19(15)10-11-9-17-14-7-3-4-8-18(11)14/h1-9H,10H2
InChI key:InChIKey=RZBYANGUENEZSP-UHFFFAOYSA-N
SMILES:O=C1C=2C(C(=O)N1CC=3N4C(=NC3)C=CC=C4)=CC=CC2
Synonyms:
  • 1H-Isoindole-1,3(2H)-dione, 2-(imidazo[1,2-a]pyridin-3-ylmethyl)-
  • 2-(Imidazo[1,2-a]pyridin-3-ylmethyl)-1H-isoindole-1,3(2H)-dione
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.