CAS 1199215-96-7
:5-(2-Fluorophenoxy)-2-pyrazinecarboxylic acid
Description:
5-(2-Fluorophenoxy)-2-pyrazinecarboxylic acid is a chemical compound characterized by its unique structure, which includes a pyrazine ring and a fluorophenoxy group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as moderate solubility in organic solvents and potential reactivity due to the presence of functional groups. The fluorine atom in the 2-fluorophenoxy moiety can influence the compound's electronic properties, potentially enhancing its lipophilicity and biological activity. The carboxylic acid functional group contributes to its acidity and can participate in hydrogen bonding, affecting its interactions in biological systems. This compound may be of interest in pharmaceutical research, particularly in the development of new drugs, due to its potential biological activity and the presence of both aromatic and heterocyclic components. Its specific applications and behavior would depend on further studies, including its synthesis, stability, and interactions with other molecules.
Formula:C11H7FN2O3
InChI:InChI=1S/C11H7FN2O3/c12-7-3-1-2-4-9(7)17-10-6-13-8(5-14-10)11(15)16/h1-6H,(H,15,16)
InChI key:InChIKey=OFFJVHJMMWHTPR-UHFFFAOYSA-N
SMILES:O(C=1C=NC(C(O)=O)=CN1)C2=C(F)C=CC=C2
Synonyms:- 5-(2-Fluorophenoxy)-2-pyrazinecarboxylic acid
- 2-Pyrazinecarboxylic acid, 5-(2-fluorophenoxy)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.