CymitQuimica logo

CAS 1199215-99-0

:

4b,5,6,11b-Tetrahydrobenz[e]aceanthrylene-7,12-dione

Description:
4b,5,6,11b-Tetrahydrobenz[e]aceanthrylene-7,12-dione is a polycyclic aromatic compound characterized by its fused ring structure, which includes multiple aromatic systems. This compound features a dione functional group, indicating the presence of two carbonyl (C=O) groups, which significantly influences its reactivity and potential applications in organic synthesis and materials science. The tetrahydro configuration suggests that the compound has undergone partial hydrogenation, resulting in a saturated framework that can affect its electronic properties and stability. Typically, compounds of this nature exhibit interesting photophysical properties, making them candidates for use in organic electronics, such as organic light-emitting diodes (OLEDs) or organic photovoltaics. Additionally, the presence of multiple aromatic rings may contribute to strong π-π stacking interactions, which can be beneficial in solid-state applications. As with many polycyclic compounds, considerations regarding toxicity and environmental impact are essential for any practical applications. Overall, 4b,5,6,11b-Tetrahydrobenz[e]aceanthrylene-7,12-dione represents a unique structure with potential utility in advanced materials research.
Formula:C20H14O2
InChI:InChI=1S/C20H14O2/c21-19-15-8-4-2-6-12(15)18-17-13(9-10-16(17)19)11-5-1-3-7-14(11)20(18)22/h1-8,13,18H,9-10H2
InChI key:InChIKey=RPNFFALBIIRQPH-UHFFFAOYSA-N
SMILES:O=C1C2C=3C(C=4C1=CC=CC4)CCC3C(=O)C=5C2=CC=CC5
Synonyms:
  • 4b,5,6,11b-Tetrahydrobenz[e]aceanthrylene-7,12-dione
  • Benz[e]aceanthrylene-7,12-dione, 4b,5,6,11b-tetrahydro-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.