CymitQuimica logo

CAS 1199216-01-7

:

N-[2-(5-Amino-1,3,4-thiadiazol-2-yl)ethyl]-3,4-dimethoxybenzamide

Description:
N-[2-(5-Amino-1,3,4-thiadiazol-2-yl)ethyl]-3,4-dimethoxybenzamide is a chemical compound characterized by its unique structural features, which include a thiadiazole ring and a benzamide moiety. The presence of the amino group on the thiadiazole enhances its potential for biological activity, making it of interest in pharmaceutical research. The dimethoxy groups on the benzene ring contribute to its lipophilicity and may influence its interaction with biological targets. This compound is likely to exhibit properties such as solubility in organic solvents and potential reactivity due to the functional groups present. Its molecular structure suggests possible applications in medicinal chemistry, particularly in the development of new therapeutic agents. Additionally, the compound's CAS number, 1199216-01-7, serves as a unique identifier for regulatory and safety information. Overall, the characteristics of this compound make it a subject of interest for further investigation in various chemical and biological contexts.
Formula:C13H16N4O3S
InChI:InChI=1S/C13H16N4O3S/c1-19-9-4-3-8(7-10(9)20-2)12(18)15-6-5-11-16-17-13(14)21-11/h3-4,7H,5-6H2,1-2H3,(H2,14,17)(H,15,18)
InChI key:InChIKey=UTFWABGPSMLLSW-UHFFFAOYSA-N
SMILES:C(NCCC=1SC(N)=NN1)(=O)C2=CC(OC)=C(OC)C=C2
Synonyms:
  • Benzamide, N-[2-(5-amino-1,3,4-thiadiazol-2-yl)ethyl]-3,4-dimethoxy-
  • N-[2-(5-Amino-1,3,4-thiadiazol-2-yl)ethyl]-3,4-dimethoxybenzamide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.