CAS 1199216-05-1
:2-Azido-N-[4-(1H-1,2,4-triazol-1-ylmethyl)phenyl]acetamide
Description:
2-Azido-N-[4-(1H-1,2,4-triazol-1-ylmethyl)phenyl]acetamide is a chemical compound characterized by the presence of an azido group (-N3) and a triazole moiety, which contributes to its potential biological activity. The compound features an acetamide functional group, indicating it may exhibit amide-like properties, such as hydrogen bonding capabilities. The triazole ring is known for its stability and ability to participate in various chemical reactions, making this compound of interest in medicinal chemistry and drug development. Its structure suggests potential applications in areas such as antimicrobial or anticancer research, given the bioactive nature of triazole derivatives. The azido group can also serve as a versatile functional handle for further chemical modifications or click chemistry applications. Overall, this compound's unique structural features may provide a foundation for exploring its reactivity and biological interactions, although specific properties such as solubility, melting point, and toxicity would require empirical investigation.
Formula:C11H11N7O
InChI:InChI=1S/C11H11N7O/c12-17-14-5-11(19)16-10-3-1-9(2-4-10)6-18-8-13-7-15-18/h1-4,7-8H,5-6H2,(H,16,19)
InChI key:InChIKey=IJTCIBMHJLVDBT-UHFFFAOYSA-N
SMILES:C(C1=CC=C(NC(CN=[N+]=[N-])=O)C=C1)N2C=NC=N2
Synonyms:- 2-Azido-N-[4-(1H-1,2,4-triazol-1-ylmethyl)phenyl]acetamide
- Acetamide, 2-azido-N-[4-(1H-1,2,4-triazol-1-ylmethyl)phenyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.