CAS 119942-70-0
:MK 912
Description:
MK 912, identified by its CAS number 119942-70-0, is a synthetic compound that belongs to the class of chemical substances known as selective serotonin reuptake inhibitors (SSRIs). It is primarily studied for its potential applications in the treatment of various psychiatric disorders, particularly depression and anxiety. The compound exhibits a mechanism of action that involves the inhibition of serotonin reuptake, thereby increasing the availability of serotonin in the synaptic cleft, which can enhance mood and emotional regulation. MK 912 is characterized by its specific binding affinity to serotonin transporters, which is crucial for its therapeutic effects. Additionally, it may possess a favorable pharmacokinetic profile, contributing to its efficacy and safety in clinical settings. As with many SSRIs, potential side effects may include gastrointestinal disturbances, changes in weight, and effects on sexual function. Ongoing research continues to explore its full therapeutic potential and safety profile in various populations.
Formula:C20H25N3O2·ClH
InChI:InChI=1S/C20H25N3O2.ClH/c1-21-11-8-20(22(2)19(21)24)9-12-23-10-7-15-14-5-3-4-6-17(14)25-18(15)16(23)13-20;/h3-6,16H,7-13H2,1-2H3;1H/t16-,20+;/m0./s1
InChI key:InChIKey=ALYCEQJIRFYVGE-VASSOYJASA-N
SMILES:CN1[C@]2(C[C@]3(C4=C(C=5C(O4)=CC=CC5)CCN3CC2)[H])CCN(C)C1=O.Cl
Synonyms:- (2S,12bS)-1',3'-dimethyl-1,3,4,5',6,6',7,12b-octahydro-1'H-spiro[1-benzofuro[2,3-a]quinolizine-2,4'-pyrimidin]-2'(3'H)-one hydrochloride (1:1)
- (2S-Trans)-1,3,4,5',6,6',7,12B-Octahydro-1',3'-Dimethyl-Spiro[2H-Benzofuro[2,3-A]Quinolizine-2,4'(1'H)-Pyrimidin]-2'(3'H)-One Hydrochloride Hydrate
- L 657743
- L 657743-002W
- L-657,743, (2S-trans)-1,3,4,5μ,6,6μ,7,12b-Octahydro-1μ,3μ-dimethyl-spiro[2H-benzofuro[2,3-a]quinolizine-2,4μ(1H)-pyrimidin]-2μ(3H)-one hydrate hydrochloride
- Mk 0912
- Mk 912
- Spiro[2H-benzofuro[2,3-a]quinolizine-2,4′(1′H)-pyrimidin]-2′(3′H)-one, 1,3,4,5′,6,6′,7,12b-octahydro-1′,3′-dimethyl-, hydrochloride (1:1), (2S,12bS)-
- Spiro[2H-benzofuro[2,3-a]quinolizine-2,4′(1′H)-pyrimidin]-2′(3′H)-one, 1,3,4,5′,6,6′,7,12b-octahydro-1′,3′-dimethyl-, monohydrochloride, (2S,12bS)-
- Spiro[2H-benzofuro[2,3-a]quinolizine-2,4′(1′H)-pyrimidin]-2′(3′H)-one, 1,3,4,5′,6,6′,7,12b-octahydro-1′,3′-dimethyl-, monohydrochloride, (2S-trans)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
Spiro[2H-benzofuro[2,3-a]quinolizine-2,4'(1'H)-pyrimidin]-2'(3'H)-one, 1,3,4,5',6,6',7,12b-octahydro-1',3'-dimethyl-, hydrochloride (1:1), (2S,12bS)-
CAS:Formula:C20H26ClN3O2Molecular weight:375.8923MK-912
CAS:MK-912: potent oral alpha2-adrenergic antagonist, studies FPG and islet function in NIDDM.Formula:C20H26ClN3O2Color and Shape:SolidMolecular weight:375.89

