CymitQuimica logo

CAS 119951-95-0

:

bis(pentafluorobenzyl)disulfide

Description:
Bis(pentafluorobenzyl)disulfide is a chemical compound characterized by its unique structure, which features two pentafluorobenzyl groups attached to a disulfide linkage. The presence of multiple fluorine atoms in the pentafluorobenzyl moiety significantly enhances the compound's lipophilicity and stability, making it resistant to oxidation and degradation. This compound is typically a colorless to pale yellow liquid or solid, depending on the temperature and purity. Its high electronegativity due to the fluorine atoms contributes to its reactivity, particularly in nucleophilic substitution reactions. Bis(pentafluorobenzyl)disulfide is often utilized in organic synthesis and materials science, particularly in the development of fluorinated polymers and as a reagent in various chemical transformations. Additionally, its unique properties make it of interest in the field of medicinal chemistry, where fluorinated compounds are often explored for their biological activity. Safety precautions should be observed when handling this compound, as it may pose health risks due to its chemical reactivity and potential toxicity.
Formula:C14H4F10S2
InChI:InChI=1/C14H4F10S2/c15-5-3(6(16)10(20)13(23)9(5)19)1-25-26-2-4-7(17)11(21)14(24)12(22)8(4)18/h1-2H2
SMILES:C(c1c(c(c(c(c1F)F)F)F)F)SSCc1c(c(c(c(c1F)F)F)F)F
Synonyms:
  • Bpfbd
  • Disulfide, bis((pentafluorophenyl)methyl)
  • 1,1'-(Disulfanediyldimethanediyl)Bis(Pentafluorobenzene)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.