CAS 1199556-87-0
:2-[1-(4-Bromophenyl)-3-oxocyclobutyl]-1H-isoindole-1,3(2H)-dione
Description:
2-[1-(4-Bromophenyl)-3-oxocyclobutyl]-1H-isoindole-1,3(2H)-dione is a chemical compound characterized by its complex structure, which includes an isoindole core and a cyclobutyl moiety. The presence of a bromophenyl group introduces significant electronic effects, influencing the compound's reactivity and potential applications. This substance features a diketone functional group, which can participate in various chemical reactions, including nucleophilic additions and condensation reactions. Its molecular structure suggests potential biological activity, making it a candidate for pharmaceutical research. The compound's solubility, stability, and reactivity can vary based on the solvent and environmental conditions, which are critical for its application in synthetic chemistry or drug development. Additionally, the bromine substituent may enhance the compound's lipophilicity, affecting its interaction with biological targets. Overall, this compound represents a unique scaffold for further exploration in medicinal chemistry and material science.
Formula:C18H12BrNO3
InChI:InChI=1S/C18H12BrNO3/c19-12-7-5-11(6-8-12)18(9-13(21)10-18)20-16(22)14-3-1-2-4-15(14)17(20)23/h1-8H,9-10H2
InChI key:InChIKey=GSLJDPZJCAZEKA-UHFFFAOYSA-N
SMILES:O=C1N(C2(CC(=O)C2)C3=CC=C(Br)C=C3)C(=O)C=4C1=CC=CC4
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
2-(1-(4-Bromophenyl)-3-oxocyclobutyl)isoindoline-1,3-dione
CAS:Formula:C18H12BrNO3Molecular weight:370.19682-(1-(4-Bromophenyl)-3-oxocyclobutyl)isoindoline-1,3-dione
CAS:Controlled ProductFormula:C18H12BrNO3Color and Shape:NeatMolecular weight:370.197

