CAS 1199589-75-7

3-(4-Bromo-3-chlorophenyl)-5-methyl-1,2,4-oxadiazole

Description:

3-(4-Bromo-3-chlorophenyl)-5-methyl-1,2,4-oxadiazole is a heterocyclic organic compound characterized by the presence of an oxadiazole ring, which consists of two nitrogen atoms and three carbon atoms in a five-membered ring. The compound features a phenyl group substituted with both bromine and chlorine atoms, contributing to its potential reactivity and biological activity. The methyl group at the 5-position of the oxadiazole ring enhances its lipophilicity, which may influence its solubility and interaction with biological systems. This compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry. Its structural features suggest potential applications in agrochemicals or pharmaceuticals, particularly in the development of new drugs or as a building block for more complex molecules. The presence of halogen substituents can also affect the compound's electronic properties, potentially enhancing its reactivity in various chemical reactions. Overall, this compound represents a unique combination of functional groups that may lead to diverse applications in chemical research.

Formula: C₉H₆BrClN₂O

InChI: InChI=1S/C9H6BrClN2O/c1-5-12-9(13-14-5)6-2-3-7(10)8(11)4-6/h2-4H,1H3

InChI key: InChIKey=OTCCOOYSTQRTCS-UHFFFAOYSA-N

SMILES: ClC=1C=C(C=CC1Br)C=2N=C(C)ON2

Synonyms:

• 3-(4-Bromo-3-chlorophenyl)-5-methyl-1,2,4-oxadiazole
• 1,2,4-Oxadiazole, 3-(4-bromo-3-chlorophenyl)-5-methyl-