CAS 1199616-73-3

B-(4-Fluoro[1,1′-biphenyl]-3-yl)boronic acid

Description:

B-(4-Fluoro[1,1′-biphenyl]-3-yl)boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group attached to a biphenyl structure with a fluorine substituent. This compound typically exhibits properties such as being a white to off-white solid at room temperature, with moderate solubility in polar organic solvents like methanol and ethanol, while being less soluble in non-polar solvents. The boronic acid group is known for its ability to form reversible covalent bonds with diols, making it useful in various applications, including organic synthesis and medicinal chemistry. The presence of the fluorine atom can enhance the compound's electronic properties and influence its reactivity. Additionally, this compound may be utilized in the development of pharmaceuticals, agrochemicals, and as a building block in materials science. Safety data should be consulted for handling and storage, as boronic acids can be sensitive to moisture and may require specific precautions.

Formula: C₁₂H₁₀BFO₂

InChI: InChI=1S/C12H10BFO2/c14-12-7-6-10(8-11(12)13(15)16)9-4-2-1-3-5-9/h1-8,15-16H

InChI key: InChIKey=FWNPBPIXFRESBL-UHFFFAOYSA-N

SMILES: B(O)(O)C=1C=C(C=CC1F)C2=CC=CC=C2

Synonyms:

• B-(4-Fluoro[1,1′-biphenyl]-3-yl)boronic acid
• Boronic acid, B-(4-fluoro[1,1′-biphenyl]-3-yl)-

Boronic acid, B-(4-fluoro[1,1′-biphenyl]-3-yl)-

CAS: 1199616-73-3

Formula: C₁₂H₁₀BFO₂

Purity: %

Molecular weight: 216.0160

Ref: IN-DA01QRAC

(4-Fluoro-[1,1'-biphenyl]-3-yl)boronic acid

CAS: 1199616-73-3

(4-Fluoro-[1,1'-biphenyl]-3-yl)boronic acid

Purity: 98%

Molecular weight: 216.02g/mol

Ref: 54-PC1006389