CAS 1199773-05-1
:1-Bromo-3-(cyclobutylthio)benzene
Description:
1-Bromo-3-(cyclobutylthio)benzene is an organic compound characterized by the presence of a bromine atom and a cyclobutylthio group attached to a benzene ring. The molecular structure features a bromine substituent at the meta position relative to the cyclobutylthio group, which consists of a cyclobutane ring bonded to a sulfur atom. This compound is typically classified as an aryl halide due to the presence of the bromine atom, which can influence its reactivity and physical properties. The cyclobutylthio group introduces unique steric and electronic effects, potentially affecting the compound's solubility, boiling point, and reactivity in various chemical reactions. As with many organobromine compounds, it may participate in nucleophilic substitution reactions, making it useful in synthetic organic chemistry. Safety and handling precautions should be observed, as brominated compounds can be hazardous. Overall, 1-Bromo-3-(cyclobutylthio)benzene represents a versatile structure for further chemical exploration and application in research and industry.
Formula:C10H11BrS
InChI:InChI=1S/C10H11BrS/c11-8-3-1-6-10(7-8)12-9-4-2-5-9/h1,3,6-7,9H,2,4-5H2
InChI key:InChIKey=LTCYNLBUEQSIOW-UHFFFAOYSA-N
SMILES:S(C1=CC(Br)=CC=C1)C2CCC2
Synonyms:- Benzene, 1-bromo-3-(cyclobutylthio)-
- 1-Bromo-3-(cyclobutylthio)benzene
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
