CymitQuimica logo

CAS 1199773-07-3

:

1-(3-Bromo-5-methylphenyl)pyrrolidine

Description:
1-(3-Bromo-5-methylphenyl)pyrrolidine is a chemical compound characterized by its unique structure, which consists of a pyrrolidine ring attached to a phenyl group that is further substituted with a bromine atom and a methyl group. The presence of the bromine atom introduces notable reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions and coupling reactions. The methyl group enhances the hydrophobic character of the molecule, influencing its solubility and interaction with biological systems. This compound may exhibit interesting pharmacological properties due to its structural features, which could affect its binding affinity to biological targets. Additionally, the presence of the pyrrolidine ring suggests potential applications in medicinal chemistry, particularly in the development of new therapeutic agents. As with many brominated compounds, considerations regarding environmental impact and safety are essential, given the potential for bioaccumulation and toxicity. Overall, 1-(3-Bromo-5-methylphenyl)pyrrolidine represents a versatile structure with implications in both synthetic and medicinal chemistry.
Formula:C11H14BrN
InChI:InChI=1S/C11H14BrN/c1-9-6-10(12)8-11(7-9)13-4-2-3-5-13/h6-8H,2-5H2,1H3
InChI key:InChIKey=XCHZZMSGUDXAGD-UHFFFAOYSA-N
SMILES:BrC=1C=C(C=C(C)C1)N2CCCC2
Synonyms:
  • 1-(3-Bromo-5-methylphenyl)pyrrolidine
  • Pyrrolidine, 1-(3-bromo-5-methylphenyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.