CymitQuimica logo

CAS 1199773-08-4

:

2-Bromo-1-(2-pyridinyl)-1-butanone

Description:
2-Bromo-1-(2-pyridinyl)-1-butanone is an organic compound characterized by the presence of a bromine atom, a pyridine ring, and a ketone functional group. Its molecular structure features a butanone backbone, where the bromine substituent is located at the first carbon, and a pyridine ring is attached to the second carbon. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and temperature. It is soluble in organic solvents such as ethanol and dichloromethane but has limited solubility in water due to its hydrophobic characteristics. The presence of the bromine atom enhances its reactivity, making it useful in various chemical synthesis applications, particularly in the formation of carbon-carbon bonds and as an intermediate in the synthesis of pharmaceuticals and agrochemicals. Additionally, the pyridine moiety contributes to its potential biological activity, as many pyridine-containing compounds exhibit significant pharmacological properties. Safety precautions should be taken when handling this compound, as it may pose health risks due to its reactivity and potential toxicity.
Formula:C9H10BrNO
InChI:InChI=1S/C9H10BrNO/c1-2-7(10)9(12)8-5-3-4-6-11-8/h3-7H,2H2,1H3
InChI key:InChIKey=PMAMKVXETFDLHM-UHFFFAOYSA-N
SMILES:C(C(CC)Br)(=O)C1=CC=CC=N1
Synonyms:
  • 1-Butanone, 2-bromo-1-(2-pyridinyl)-
  • 2-Bromo-1-(2-pyridinyl)-1-butanone
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.