CAS 1199773-10-8

1,3-Diethyl 2-[[(2-amino-4-chlorophenyl)amino]methylene]propanedioate

Description:

1,3-Diethyl 2-[[(2-amino-4-chlorophenyl)amino]methylene]propanedioate, identified by its CAS number 1199773-10-8, is a chemical compound that features a complex structure characterized by the presence of both diethyl and amino groups. This compound belongs to the class of propanedioates, which are esters or salts derived from malonic acid. The presence of a 4-chlorophenyl group indicates that it has potential applications in medicinal chemistry, particularly in the development of pharmaceuticals due to the biological activity often associated with chlorinated aromatic compounds. The amino groups suggest that it may participate in hydrogen bonding, influencing its solubility and reactivity. Additionally, the methylene bridge in the structure can provide flexibility, potentially affecting the compound's interaction with biological targets. Overall, this compound's unique structural features may contribute to its potential utility in various chemical and biological applications, although specific properties such as solubility, melting point, and reactivity would require empirical data for precise characterization.

Formula: C₁₄H₁₇ClN₂O₄

InChI: InChI=1S/C14H17ClN2O4/c1-3-20-13(18)10(14(19)21-4-2)8-17-12-6-5-9(15)7-11(12)16/h5-8,17H,3-4,16H2,1-2H3

InChI key: InChIKey=ONHHJGPYSIGPRH-UHFFFAOYSA-N

SMILES: C(=CNC1=C(N)C=C(Cl)C=C1)(C(OCC)=O)C(OCC)=O

Synonyms:

• 1,3-Diethyl 2-[[(2-amino-4-chlorophenyl)amino]methylene]propanedioate
• Propanedioic acid, 2-[[(2-amino-4-chlorophenyl)amino]methylene]-, 1,3-diethyl ester

Diethyl 2-((2-amino-4-chlorophenylamino)methylene)malonate

CAS: 1199773-10-8

Formula: C₁₄H₁₇ClN₂O₄

Molecular weight: 312.7488

Ref: IN-DA000PWI