CymitQuimica logo

CAS 1199773-13-1

:

1H-Benzimidazole, 5-bromo-1-propyl-, hydrochloride (1:1)

Description:
1H-Benzimidazole, 5-bromo-1-propyl-, hydrochloride (1:1) is a chemical compound characterized by its benzimidazole core structure, which is a bicyclic compound containing a fused benzene and imidazole ring. The presence of a bromine atom at the 5-position of the benzimidazole ring introduces halogen functionality, which can influence the compound's reactivity and biological activity. The propyl group at the 1-position enhances its lipophilicity, potentially affecting its solubility and permeability in biological systems. As a hydrochloride salt, it is typically more stable and soluble in aqueous solutions, making it suitable for various applications, including pharmaceutical formulations. This compound may exhibit biological activities, such as antimicrobial or anticancer properties, due to the structural features of the benzimidazole moiety, which is known for its diverse pharmacological effects. Safety and handling precautions should be observed, as with all chemical substances, particularly those with halogen substituents.
Formula:C10H11BrN2·ClH
InChI:InChI=1S/C10H11BrN2.ClH/c1-2-5-13-7-12-9-6-8(11)3-4-10(9)13;/h3-4,6-7H,2,5H2,1H3;1H
InChI key:InChIKey=XOFBBZYKXVDVKS-UHFFFAOYSA-N
SMILES:C(CC)N1C=2C(=CC(Br)=CC2)N=C1.Cl
Synonyms:
  • 1H-Benzimidazole, 5-bromo-1-propyl-, hydrochloride (1:1)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.