CymitQuimica logo

CAS 1199773-14-2

:

Methyl 1-(1-methylethyl)-1H-benzimidazole-6-carboxylate

Description:
Methyl 1-(1-methylethyl)-1H-benzimidazole-6-carboxylate is a chemical compound characterized by its benzimidazole core, which is a bicyclic structure containing both benzene and imidazole rings. This compound features a methyl ester functional group, contributing to its solubility in organic solvents. The presence of the isopropyl group (1-methylethyl) enhances its hydrophobic characteristics, potentially influencing its biological activity and interactions. The carboxylate group indicates that it can participate in various chemical reactions, such as esterification or amidation. This compound may exhibit interesting pharmacological properties, making it of interest in medicinal chemistry. Its molecular structure suggests potential applications in drug development, particularly in targeting specific biological pathways. Additionally, the compound's stability and reactivity can be influenced by factors such as pH and temperature, which are important considerations in both laboratory and industrial settings. Overall, Methyl 1-(1-methylethyl)-1H-benzimidazole-6-carboxylate represents a versatile structure with potential utility in various chemical and pharmaceutical applications.
Formula:C12H14N2O2
InChI:InChI=1S/C12H14N2O2/c1-8(2)14-7-13-10-5-4-9(6-11(10)14)12(15)16-3/h4-8H,1-3H3
InChI key:InChIKey=WSQONGVHLXDVAQ-UHFFFAOYSA-N
SMILES:C(C)(C)N1C=2C(N=C1)=CC=C(C(OC)=O)C2
Synonyms:
  • Methyl 1-(1-methylethyl)-1H-benzimidazole-6-carboxylate
  • 1H-Benzimidazole-6-carboxylic acid, 1-(1-methylethyl)-, methyl ester
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.