CymitQuimica logo

CAS 1199773-17-5

:

1-[[4-(4-Bromo-1H-pyrazol-1-yl)phenyl]sulfonyl]piperidine

Description:
1-[[4-(4-Bromo-1H-pyrazol-1-yl)phenyl]sulfonyl]piperidine is a chemical compound characterized by its complex structure, which includes a piperidine ring, a sulfonyl group, and a bromo-substituted pyrazole moiety. The presence of the sulfonyl group indicates potential for strong intermolecular interactions, such as hydrogen bonding, which can influence its solubility and reactivity. The bromo substituent on the pyrazole ring may enhance the compound's biological activity and lipophilicity, making it of interest in medicinal chemistry. This compound is likely to exhibit specific pharmacological properties, potentially acting as a ligand or inhibitor in various biological pathways. Its molecular structure suggests it may be useful in the development of pharmaceuticals, particularly in targeting specific receptors or enzymes. Additionally, the presence of heteroatoms and functional groups may contribute to its reactivity in organic synthesis and its stability under various conditions. Overall, this compound represents a class of sulfonamide derivatives that are often explored for their therapeutic potential.
Formula:C14H16BrN3O2S
InChI:InChI=1S/C14H16BrN3O2S/c15-12-10-16-18(11-12)13-4-6-14(7-5-13)21(19,20)17-8-2-1-3-9-17/h4-7,10-11H,1-3,8-9H2
InChI key:InChIKey=GRSHOZSMDJHJEH-UHFFFAOYSA-N
SMILES:BrC1=CN(C2=CC=C(S(=O)(=O)N3CCCCC3)C=C2)N=C1
Synonyms:
  • 1-[[4-(4-Bromo-1H-pyrazol-1-yl)phenyl]sulfonyl]piperidine
  • Piperidine, 1-[[4-(4-bromo-1H-pyrazol-1-yl)phenyl]sulfonyl]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.