CAS 1199773-18-6
:2,4,6-Trimethylbenzenesulfonic acid 2-(1,4-dioxaspiro[4.5]dec-8-ylidene)hydrazide
Description:
2,4,6-Trimethylbenzenesulfonic acid 2-(1,4-dioxaspiro[4.5]dec-8-ylidene)hydrazide is a complex organic compound characterized by its sulfonic acid functional group and a hydrazide moiety. The presence of the trimethylbenzene structure contributes to its hydrophobic characteristics, while the sulfonic acid group imparts significant water solubility and acidity, making it useful in various chemical applications. The dioxaspiro structure introduces a unique cyclic framework that can influence the compound's reactivity and stability. This compound may exhibit properties such as potential antimicrobial activity or serve as a reagent in organic synthesis due to the presence of the hydrazide functional group, which is known for its ability to form hydrazones and other derivatives. Additionally, the intricate structure may allow for specific interactions in biological systems or catalysis. Overall, this compound's unique combination of functional groups and structural features makes it a subject of interest in both synthetic and applied chemistry.
Formula:C17H24N2O4S
InChI:InChI=1S/C17H24N2O4S/c1-12-10-13(2)16(14(3)11-12)24(20,21)19-18-15-4-6-17(7-5-15)22-8-9-23-17/h10-11,19H,4-9H2,1-3H3
InChI key:InChIKey=USQCRRQVCMGNMM-UHFFFAOYSA-N
SMILES:S(NN=C1CCC2(CC1)OCCO2)(=O)(=O)C3=C(C)C=C(C)C=C3C
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
2,4,6-Trimethyl-N'-(1,4-dioxaspiro[4.5]decan-8-ylidene)benzenesulfonohydrazide
CAS:Formula:C17H24N2O4SMolecular weight:352.4485
