CAS 1199773-19-7

Piperazine, 1-(3-bromo-5-methyl-2-pyridinyl)-4-ethyl-, hydrochloride (1:1)

Description:

Piperazine, 1-(3-bromo-5-methyl-2-pyridinyl)-4-ethyl-, hydrochloride (1:1) is a chemical compound characterized by its piperazine core, which is a six-membered heterocyclic amine. The presence of a 3-bromo-5-methyl-2-pyridinyl substituent indicates that it has a bromine atom and a methyl group attached to a pyridine ring, contributing to its unique properties. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, particularly in pharmaceuticals. The compound may exhibit biological activity, potentially acting as a pharmacological agent, and its structure suggests it could interact with neurotransmitter systems. Its molecular structure and substituents may influence its lipophilicity, stability, and reactivity. Safety and handling precautions should be observed, as with any chemical substance, particularly in laboratory or industrial settings. Further studies would be necessary to fully elucidate its properties and potential applications.

Formula: C₁₂H₁₈BrN₃·ClH

InChI: InChI=1S/C12H18BrN3.ClH/c1-3-15-4-6-16(7-5-15)12-11(13)8-10(2)9-14-12;/h8-9H,3-7H2,1-2H3;1H

InChI key: InChIKey=FVYJULXSGWDUGE-UHFFFAOYSA-N

SMILES: BrC1=C(N2CCN(CC)CC2)N=CC(C)=C1.Cl

Synonyms:

• Piperazine, 1-(3-bromo-5-methyl-2-pyridinyl)-4-ethyl-, hydrochloride (1:1)

3-Bromo-2-(4-ethylpiperazino)-5-methylpyridine, HCl

CAS: 1199773-19-7

Formula: C₁₂H₁₉BrClN₃

Molecular weight: 320.6564

Ref: IN-DA000PXN