CymitQuimica logo

CAS 1199773-22-2

:

5-Bromo-1-cyclohexyl-1H-benzimidazole

Description:
5-Bromo-1-cyclohexyl-1H-benzimidazole is a chemical compound characterized by its unique structure, which includes a benzimidazole core substituted with a bromine atom and a cyclohexyl group. This compound typically exhibits properties associated with heterocyclic compounds, including potential biological activity due to the presence of the benzimidazole moiety, which is known for its role in various pharmacological applications. The bromine substitution can influence the compound's reactivity and solubility, while the cyclohexyl group may enhance lipophilicity, affecting its interaction with biological membranes. In terms of physical properties, it may be a solid at room temperature, with specific melting and boiling points dependent on its molecular interactions. The compound's stability, solubility in organic solvents, and potential for forming hydrogen bonds are also important characteristics that can influence its behavior in chemical reactions and biological systems. Overall, 5-Bromo-1-cyclohexyl-1H-benzimidazole is of interest in medicinal chemistry and materials science due to its structural features and potential applications.
Formula:C13H15BrN2
InChI:InChI=1S/C13H15BrN2/c14-10-6-7-13-12(8-10)15-9-16(13)11-4-2-1-3-5-11/h6-9,11H,1-5H2
InChI key:InChIKey=WTLYFSPRQFBUHC-UHFFFAOYSA-N
SMILES:BrC=1C=C2C(N(C=N2)C3CCCCC3)=CC1
Synonyms:
  • 1H-Benzimidazole, 5-bromo-1-cyclohexyl-
  • 5-Bromo-1-cyclohexyl-1H-benzimidazole
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.