CymitQuimica logo

CAS 1199773-26-6

:

4-(4-Bromo-1H-pyrazol-1-yl)-N,N-dimethylbenzenesulfonamide

Description:
4-(4-Bromo-1H-pyrazol-1-yl)-N,N-dimethylbenzenesulfonamide is a chemical compound characterized by its complex structure, which includes a pyrazole ring and a sulfonamide functional group. The presence of the bromine atom on the pyrazole ring contributes to its reactivity and potential applications in medicinal chemistry. The dimethyl group attached to the nitrogen of the sulfonamide enhances its solubility and may influence its biological activity. This compound is typically used in research settings, particularly in the development of pharmaceuticals, due to its potential as a bioactive molecule. Its sulfonamide moiety is known for its antibacterial properties, while the pyrazole ring can be involved in various biological interactions. The compound's molecular structure suggests it may exhibit specific interactions with biological targets, making it of interest in drug discovery and development. As with many chemical substances, safety and handling precautions are essential due to potential toxicity or reactivity.
Formula:C11H12BrN3O2S
InChI:InChI=1S/C11H12BrN3O2S/c1-14(2)18(16,17)11-5-3-10(4-6-11)15-8-9(12)7-13-15/h3-8H,1-2H3
InChI key:InChIKey=VUMXAXLUEPRPNP-UHFFFAOYSA-N
SMILES:BrC1=CN(C2=CC=C(S(N(C)C)(=O)=O)C=C2)N=C1
Synonyms:
  • 4-(4-Bromo-1H-pyrazol-1-yl)-N,N-dimethylbenzenesulfonamide
  • Benzenesulfonamide, 4-(4-bromo-1H-pyrazol-1-yl)-N,N-dimethyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.