CAS 1199773-33-5
:1-(1,1-Dimethylethyl)-1H-benzimidazole-6-carboxylic acid
Description:
1-(1,1-Dimethylethyl)-1H-benzimidazole-6-carboxylic acid is a chemical compound characterized by its unique structure, which includes a benzimidazole ring substituted with a tert-butyl group and a carboxylic acid functional group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as stability and potential for hydrogen bonding due to the presence of the carboxylic acid. The tert-butyl group contributes to its lipophilicity, which may influence its solubility in organic solvents. Additionally, the benzimidazole moiety is known for its biological activity, often serving as a scaffold in pharmaceuticals. The presence of the carboxylic acid group can enhance its reactivity and interaction with biological targets. Overall, this compound may be of interest in medicinal chemistry and material science due to its structural features and potential applications.
Formula:C12H14N2O2
InChI:InChI=1S/C12H14N2O2/c1-12(2,3)14-7-13-9-5-4-8(11(15)16)6-10(9)14/h4-7H,1-3H3,(H,15,16)
InChI key:InChIKey=AGJWGCANKYVLTQ-UHFFFAOYSA-N
SMILES:C(C)(C)(C)N1C=2C(N=C1)=CC=C(C(O)=O)C2
Synonyms:- 1H-Benzimidazole-6-carboxylic acid, 1-(1,1-dimethylethyl)-
- 1-(1,1-Dimethylethyl)-1H-benzimidazole-6-carboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
