CAS 1199773-45-9
:3-Bromo-5-chloro-4-methyl-2(1H)-pyridinone
Description:
3-Bromo-5-chloro-4-methyl-2(1H)-pyridinone is a heterocyclic organic compound characterized by its pyridinone structure, which features a pyridine ring with a ketone functional group. The presence of bromine and chlorine substituents at the 3 and 5 positions, respectively, along with a methyl group at the 4 position, contributes to its unique chemical properties. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar organic solvents. Its molecular structure suggests potential reactivity due to the halogen substituents, which can participate in nucleophilic substitution reactions. Additionally, the compound may possess biological activity, making it of interest in pharmaceutical research. The presence of the pyridinone moiety may also confer properties such as chelation with metal ions. Safety data should be consulted for handling, as halogenated compounds can pose health risks. Overall, 3-Bromo-5-chloro-4-methyl-2(1H)-pyridinone is a compound of interest in both synthetic and medicinal chemistry contexts.
Formula:C6H5BrClNO
InChI:InChI=1S/C6H5BrClNO/c1-3-4(8)2-9-6(10)5(3)7/h2H,1H3,(H,9,10)
InChI key:InChIKey=IKLYPWQHGKGSAQ-UHFFFAOYSA-N
SMILES:BrC1=C(C)C(Cl)=CNC1=O
Synonyms:- 3-Bromo-5-chloro-4-methylpyridin-2-ol
- 3-Bromo-5-chloro-4-methyl-2(1H)-pyridinone
- 2(1H)-Pyridinone, 3-bromo-5-chloro-4-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
