CAS 1199773-69-7

Methyl 3H-imidazo[4,5-c]pyridine-2-carboxylate

Description:

Methyl 3H-imidazo[4,5-c]pyridine-2-carboxylate is a heterocyclic organic compound characterized by its imidazole and pyridine ring structures, which contribute to its unique chemical properties. This compound typically exhibits a molecular formula that includes carbon, hydrogen, nitrogen, and oxygen atoms, reflecting its complex structure. It is known for its potential biological activity, making it of interest in medicinal chemistry and drug development. The presence of the carboxylate group enhances its reactivity and solubility in various solvents, which is advantageous for synthetic applications. Additionally, the methyl ester functionality can influence its pharmacokinetic properties, such as absorption and metabolism. Methyl 3H-imidazo[4,5-c]pyridine-2-carboxylate may also participate in various chemical reactions, including nucleophilic substitutions and cycloadditions, making it a versatile building block in organic synthesis. Its specific characteristics, such as melting point, boiling point, and spectral data, would be determined through experimental methods and are essential for its identification and application in research.

Formula: C₈H₇N₃O₂

InChI: InChI=1S/C8H7N3O2/c1-13-8(12)7-10-5-2-3-9-4-6(5)11-7/h2-4H,1H3,(H,10,11)

InChI key: InChIKey=WHHFXCZPABOCAC-UHFFFAOYSA-N

SMILES: C(OC)(=O)C=1NC=2C(N1)=CN=CC2

Synonyms:

• 3H-Imidazo[4,5-c]pyridine-2-carboxylic acid, methyl ester
• Methyl 3H-imidazo[4,5-c]pyridine-2-carboxylate