CAS 1199773-77-7
:1-Cyclohexyl-1H-pyrazole-4-carbonitrile
Description:
1-Cyclohexyl-1H-pyrazole-4-carbonitrile is a chemical compound characterized by its pyrazole ring structure, which is a five-membered aromatic ring containing two nitrogen atoms. The presence of a cyclohexyl group at the 1-position and a cyano group at the 4-position contributes to its unique chemical properties. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. It is of interest in various fields, including medicinal chemistry and agrochemicals, due to its potential biological activities. The cyano group can participate in nucleophilic reactions, while the pyrazole moiety may interact with biological targets, making it a candidate for further research. Additionally, the compound's stability and reactivity can be influenced by the substituents on the pyrazole ring and the cyclohexyl group, which can affect its overall chemical behavior and applications. Safety data and handling precautions should be considered, as with any chemical substance, to ensure proper laboratory practices.
Formula:C10H13N3
InChI:InChI=1S/C10H13N3/c11-6-9-7-12-13(8-9)10-4-2-1-3-5-10/h7-8,10H,1-5H2
InChI key:InChIKey=OXHNBHSXUDQFKV-UHFFFAOYSA-N
SMILES:C(#N)C1=CN(N=C1)C2CCCCC2
Synonyms:- 1H-Pyrazole-4-carbonitrile, 1-cyclohexyl-
- 1-Cyclohexyl-1H-pyrazole-4-carbonitrile
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.