CymitQuimica logo

CAS 1199773-81-3

:

Cyclopropanemethanamine, 2,2,3,3-tetramethyl-, hydrochloride (1:1)

Description:
Cyclopropanemethanamine, 2,2,3,3-tetramethyl-, hydrochloride (1:1) is a chemical compound characterized by its unique structure, which includes a cyclopropane ring and multiple methyl groups attached to a methanamine backbone. This compound is typically encountered as a hydrochloride salt, which enhances its solubility in water and stability. The presence of the tetramethyl groups contributes to its steric hindrance, potentially influencing its reactivity and interaction with biological systems. As a tertiary amine, it may exhibit basic properties and can participate in various chemical reactions, including alkylation and acylation. The compound's specific applications may vary, but it is often studied in the context of organic synthesis and medicinal chemistry due to its structural features. Safety data and handling precautions should be observed, as with any chemical substance, to mitigate risks associated with its use. Overall, the compound's unique structural characteristics make it a subject of interest in both academic and industrial research settings.
Formula:C8H17N·ClH
InChI:InChI=1S/C8H17N.ClH/c1-7(2)6(5-9)8(7,3)4;/h6H,5,9H2,1-4H3;1H
InChI key:InChIKey=TZEXNFFUFLKVIV-UHFFFAOYSA-N
SMILES:C(N)C1C(C)(C)C1(C)C.Cl
Synonyms:
  • Cyclopropanemethanamine, 2,2,3,3-tetramethyl-, hydrochloride (1:1)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.