CymitQuimica logo

CAS 1199782-68-7

:

6-Iodo-3(2H)-benzofuranone

Description:
6-Iodo-3(2H)-benzofuranone is a chemical compound characterized by its unique structure, which includes a benzofuranone moiety with an iodine substituent at the 6-position. This compound typically exhibits a molecular framework that combines both aromatic and heterocyclic features, contributing to its potential reactivity and applications in organic synthesis. The presence of the iodine atom can enhance the compound's electrophilic properties, making it a useful intermediate in various chemical reactions, including nucleophilic substitutions. Additionally, benzofuranones are known for their biological activity, which may include antimicrobial or anti-inflammatory properties, although specific biological data for this compound may vary. The compound's solubility, stability, and reactivity can be influenced by the presence of the iodine atom and the overall electronic structure of the benzofuranone ring. As with many halogenated compounds, safety precautions should be taken when handling 6-Iodo-3(2H)-benzofuranone due to potential toxicity and environmental impact.
Formula:C8H5IO2
InChI:InChI=1S/C8H5IO2/c9-5-1-2-6-7(10)4-11-8(6)3-5/h1-3H,4H2
InChI key:InChIKey=YWANOARZTMFITP-UHFFFAOYSA-N
SMILES:O=C1C=2C(OC1)=CC(I)=CC2
Synonyms:
  • 3(2H)-Benzofuranone, 6-iodo-
  • 6-Iodo-3(2H)-benzofuranone
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.