
CAS 1199782-89-2
:6-Chloro-2,3-dihydro-4-methoxy-1H-inden-1-one
Description:
6-Chloro-2,3-dihydro-4-methoxy-1H-inden-1-one is an organic compound characterized by its unique bicyclic structure, which includes an indene moiety. The presence of a chlorine atom at the 6-position and a methoxy group at the 4-position contributes to its chemical reactivity and potential applications in various fields, including pharmaceuticals and agrochemicals. This compound typically exhibits moderate polarity due to the methoxy group, which can influence its solubility in organic solvents. The dihydro configuration indicates that it has two hydrogen atoms added to the indene structure, affecting its stability and reactivity. Additionally, the compound may display interesting biological activities, making it a subject of interest for medicinal chemistry. Its synthesis and characterization often involve standard organic reactions, and it can be analyzed using techniques such as NMR and mass spectrometry to confirm its structure and purity. Overall, 6-Chloro-2,3-dihydro-4-methoxy-1H-inden-1-one represents a versatile scaffold for further chemical modifications and research.
Formula:C10H9ClO2
InChI:InChI=1S/C10H9ClO2/c1-13-10-5-6(11)4-8-7(10)2-3-9(8)12/h4-5H,2-3H2,1H3
InChI key:InChIKey=VNBMUUWEOODJRL-UHFFFAOYSA-N
SMILES:O(C)C1=C2C(C(=O)CC2)=CC(Cl)=C1
Synonyms:- 6-Chloro-2,3-dihydro-4-methoxy-1H-inden-1-one
- 1H-Inden-1-one, 6-chloro-2,3-dihydro-4-methoxy-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
