CAS 1199783-17-9

1H-Inden-1-amine, 4,6-dichloro-2,3-dihydro-, hydrochloride (1:1)

Description:

1H-Inden-1-amine, 4,6-dichloro-2,3-dihydro-, hydrochloride (1:1) is a chemical compound characterized by its unique bicyclic structure, which includes an indene moiety and an amine functional group. The presence of dichloro substituents at the 4 and 6 positions enhances its reactivity and potential biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, which is advantageous for various applications, including pharmaceutical formulations. This compound may exhibit properties such as basicity due to the amine group, and its dichloro substitutions can influence its electronic properties and interactions with biological targets. The compound's CAS number, 1199783-17-9, allows for precise identification in chemical databases. Its potential uses may span across medicinal chemistry, where it could serve as a lead compound for drug development, particularly in areas targeting specific receptors or pathways influenced by indene derivatives. However, detailed studies on its pharmacological profile and safety are essential for understanding its full potential.

Formula: C₉H₉Cl₂N·ClH

InChI: InChI=1S/C9H9Cl2N.ClH/c10-5-3-7-6(8(11)4-5)1-2-9(7)12;/h3-4,9H,1-2,12H2;1H

InChI key: InChIKey=PXWNKDUIGULGMU-UHFFFAOYSA-N

SMILES: ClC1=C2C(=CC(Cl)=C1)C(N)CC2.Cl

Synonyms:

• 1H-Inden-1-amine, 4,6-dichloro-2,3-dihydro-, hydrochloride (1:1)

4,6-Dichloro-2,3-dihydro-1H-inden-1-amine hydrochloride

Controlled Product

CAS: 1199783-17-9

Versatile small molecule scaffold

Formula: C₉H₁₀Cl₃N

Purity: Min. 95%

Molecular weight: 238.5 g/mol

Ref: 3D-ZXB78317