CymitQuimica logo

CAS 119979-33-8

:

helvecardin A

Description:
Helvecardin A, with the CAS number 119979-33-8, is a natural product that belongs to the class of compounds known as alkaloids. It is primarily derived from certain species of fungi, particularly those in the genus Helvella. This compound is characterized by its complex molecular structure, which includes multiple rings and functional groups that contribute to its biological activity. Helvecardin A has garnered interest in the field of medicinal chemistry due to its potential pharmacological properties, including antimicrobial and anticancer activities. Its mechanism of action and specific interactions at the molecular level are subjects of ongoing research. Additionally, the compound's solubility, stability, and reactivity can vary depending on environmental conditions, making it a topic of interest for further studies in natural product chemistry and drug development. Overall, helvecardin A represents a fascinating example of the diverse chemical entities found in nature and their potential applications in medicine.
Formula:C90H103Cl2N9O36
InChI:InChI=1/C90H103Cl2N9O36/c1-31-67(108)47(93)27-57(126-31)134-77-38-12-19-52(46(92)22-38)131-54-24-39-23-53(78(54)137-90-80(74(115)71(112)56(30-103)133-90)135-58-28-48(94)68(109)32(2)127-58)129-41-15-8-35(9-16-41)76(136-88-75(116)72(113)70(111)55(29-102)132-88)65(100-81(117)60(95-4)34-6-13-42(14-7-34)130-89-79(125-5)73(114)69(110)33(3)128-89)85(121)97-62(37-11-18-50(106)45(91)21-37)82(118)98-63(39)84(120)96-61-36-10-17-49(105)43(20-36)59-44(25-40(104)26-51(59)107)64(87(123)124)99-86(122)66(77)101-83(61)119/h6-26,31-33,47-48,55-58,60-77,79-80,88-90,95,102-116H,27-30,93-94H2,1-5H3,(H,96,120)(H,97,121)(H,98,118)(H,99,122)(H,100,117)(H,101,119)(H,123,124)/t31-,32-,33?,47-,48-,55?,56+,57-,58-,60?,61+,62?,63+,64-,65+,66-,67-,68-,69?,70?,71+,72?,73?,74?,75?,76+,77+,79?,80+,88?,89?,90-/m0/s1
Synonyms:
  • 49-Chloro-2'''''-O-methylavoparcin α
  • helvecardin A
  • 22H-8,11:18,21-Dietheno-23,36-(iminomethano)-13,16:31,35-dimetheno-1H,16H-[1,6,9]oxadiazacyclohexadecino[4,5-m][10,2,16]benzoxadiazacyclotetracosine-26-carboxylic acid, 44-[[2-O-(3-amino-2,3,6-trideoxy-α-L-ribo-hexopyranosyl)-β-D-glucopyranosyl]oxy]-22-[(3-amino-2,3,6-trideoxy-α-L-ribo-hexopyranosyl...
  • Avoparcin alpha, 49-chloro-2C-O-methyl-
  • Avoparcin alpha, 49-chloro-2(sup C)-O-methyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
  • Helvecardin A

    CAS:
    <p>Helvecardin A is a glycopeptide antibiotic with potent activity against both aerobic and anaerobic Gram-positive bacteria, including methicillin-resistant Staphylococcus aureus.</p>
    Formula:C90H103Cl2N9O36
    Color and Shape:Solid
    Molecular weight:1957.73