CymitQuimica logo

CAS 119979-34-9

:

helvecardin B

Description:
Helvecardin B, with the CAS number 119979-34-9, is a natural product that belongs to the class of compounds known as polyketides. It is primarily derived from certain species of fungi, particularly those in the genus Helvella. This compound exhibits a range of biological activities, including antimicrobial and antifungal properties, making it of interest in pharmaceutical research. Helvecardin B is characterized by its complex molecular structure, which includes multiple functional groups that contribute to its reactivity and interaction with biological systems. The compound's specific stereochemistry and functional groups play a crucial role in its biological efficacy. Additionally, like many natural products, helvecardin B may exhibit variability in its production depending on the environmental conditions and the specific strain of the producing organism. Research into helvecardin B continues to explore its potential applications in medicine and agriculture, particularly in the development of new therapeutic agents.
Formula:C84H93Cl2N9O31
InChI:InChI=1/C84H93Cl2N9O31/c1-30-65(101)46(87)27-55(117-30)124-72-37-12-19-51(45(86)22-37)122-53-24-38-23-52(73(53)126-84-75(71(107)69(105)54(29-96)123-84)125-56-28-47(88)66(102)31(2)118-56)120-40-15-8-34(9-16-40)68(104)63(94-76(108)58(89-4)33-6-13-41(14-7-33)121-83-74(116-5)70(106)67(103)32(3)119-83)80(112)91-60(36-11-18-49(99)44(85)21-36)77(109)92-61(38)79(111)90-59-35-10-17-48(98)42(20-35)57-43(25-39(97)26-50(57)100)62(82(114)115)93-81(113)64(72)95-78(59)110/h6-26,30-32,46-47,54-56,58-72,74-75,83-84,89,96-107H,27-29,87-88H2,1-5H3,(H,90,111)(H,91,112)(H,92,109)(H,93,113)(H,94,108)(H,95,110)(H,114,115)/t30-,31-,32?,46-,47-,54+,55-,56-,58?,59+,60?,61+,62-,63+,64-,65-,66-,67?,68+,69+,70?,71?,72+,74?,75+,83?,84-/m0/s1
Synonyms:
  • Helvecardin B
  • Avoparcin alpha, 49-chloro-7-O-de-alpha-D-mannopyranosyl-2(sup C)-O-methyl-
  • Avoparcin alpha, 49-chloro-7-O-de-alpha-D-mannopyranosyl-2C-O-methyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
  • Helvecardin B

    CAS:
    Helvecardin B is a glycopeptide antibiotic with potent activity against both aerobic and anaerobic Gram-positive bacteria, including methicillin-resistant Staphylococcus aureus (MRSA).
    Formula:C84H93Cl2N9O31
    Color and Shape:Solid
    Molecular weight:1795.58

    Ref: TM-TN10528

    10mg
    To inquire
    50mg
    To inquire