CymitQuimica logo

CAS 119986-79-7

:

2-[4-[2-(4-Hexylphenyl)diazenyl]phenoxy]acetyl chloride

Description:
2-[4-[2-(4-Hexylphenyl)diazenyl]phenoxy]acetyl chloride, with the CAS number 119986-79-7, is an organic compound characterized by its complex structure, which includes an acetyl chloride functional group and a diazenyl moiety. This compound features a phenoxy group, indicating the presence of an ether linkage, and a hexylphenyl substituent that contributes to its hydrophobic properties. The diazenyl group, characterized by the presence of a nitrogen-nitrogen double bond, is known for its potential applications in dye chemistry and as a chromophore in various materials. The presence of the acetyl chloride group suggests reactivity, particularly in nucleophilic acyl substitution reactions, making it useful in synthetic organic chemistry. Additionally, the compound's structure may impart specific optical properties, which could be explored in applications such as photonic devices or as intermediates in the synthesis of more complex organic molecules. Overall, this compound exemplifies the intersection of functional group chemistry and structural diversity in organic synthesis.
Formula:C20H23ClN2O2
InChI:InChI=1S/C20H23ClN2O2/c1-2-3-4-5-6-16-7-9-17(10-8-16)22-23-18-11-13-19(14-12-18)25-15-20(21)24/h7-14H,2-6,15H2,1H3
InChI key:InChIKey=LJGPJAILMQNLMK-UHFFFAOYSA-N
SMILES:N(=NC1=CC=C(CCCCCC)C=C1)C2=CC=C(OCC(Cl)=O)C=C2
Synonyms:
  • Acetyl chloride, 2-[4-[2-(4-hexylphenyl)diazenyl]phenoxy]-
  • 2-[4-[2-(4-Hexylphenyl)diazenyl]phenoxy]acetyl chloride
  • 4-(4-Hexylphenylazo)phenoxyacetyl chloride
  • Acetyl chloride, [4-[(4-hexylphenyl)azo]phenoxy]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.