CymitQuimica logo

CAS 119990-81-7

:

TRANS,TRANS-4'-(4'-PROPYLBICYCLOHEXYL-4-YL)-3,4-DIFLUOROBIPHENYL

Description:
TRANS,TRANS-4'-(4'-Propylbicyclohexyl-4-yl)-3,4-difluorobiphenyl is a chemical compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of difluoro substituents at the 3 and 4 positions on one of the phenyl rings introduces significant polarity and can influence the compound's reactivity and solubility. The bicyclohexyl moiety contributes to the compound's steric bulk and can affect its conformational flexibility. The propyl group enhances hydrophobic interactions, potentially impacting its solubility in organic solvents. This compound may exhibit interesting properties such as liquid crystalline behavior, making it relevant in materials science, particularly in the development of liquid crystal displays (LCDs) and other electronic applications. Its specific characteristics, including melting point, boiling point, and solubility, would depend on the molecular interactions and the overall structure, which can be influenced by the arrangement of the substituents. Safety and handling considerations should be taken into account due to the presence of fluorine atoms, which can impart unique toxicity profiles.
Formula:C27H34F2
InChI:InChI=1S/C27H34F2/c1-2-3-19-4-6-20(7-5-19)21-8-10-22(11-9-21)23-12-14-24(15-13-23)25-16-17-26(28)27(29)18-25/h12-22H,2-11H2,1H3
InChI key:DOTCXRSWJCSMMA-UHFFFAOYSA-N
SMILES:CCCC1CCC(CC1)C2CCC(CC2)C3=CC=C(C=C3)C4=CC(=C(C=C4)F)F
Found 5 products.