CAS 120-03-6

2-(4-methylphenyl)-1H-benzimidazole

Description:

2-(4-Methylphenyl)-1H-benzimidazole, with the CAS number 120-03-6, is an organic compound characterized by its benzimidazole core, which is a bicyclic structure containing both benzene and imidazole rings. This compound features a methyl group attached to the para position of the phenyl group, contributing to its unique properties. It is typically a crystalline solid, exhibiting moderate solubility in organic solvents. The presence of the methyl group can influence its electronic properties and reactivity, making it of interest in various chemical applications. This compound is often studied for its potential biological activities, including antimicrobial and antifungal properties. Additionally, it may serve as a building block in the synthesis of more complex organic molecules. Its stability and reactivity can vary depending on environmental conditions, such as pH and temperature. Overall, 2-(4-methylphenyl)-1H-benzimidazole is a significant compound in organic chemistry with potential applications in pharmaceuticals and materials science.

Formula: C₁₄H₁₂N₂

InChI: InChI=1/C14H12N2/c1-10-6-8-11(9-7-10)14-15-12-4-2-3-5-13(12)16-14/h2-9H,1H3,(H,15,16)

SMILES: Cc1ccc(cc1)c1[nH]c2ccccc2n1

Synonyms:

• 1H-benzimidazole, 2-(4-methylphenyl)-
• 2-(4-methylphenyl)-1H-benzo[d]imidazole

1H-Benzimidazole, 2-(4-methylphenyl)-

CAS: 120-03-6

Formula: C₁₄H₁₂N₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 208.2585

Ref: IN-DA000Q0G

2-(4-Methylphenyl)benzimidazole

CAS: 120-03-6

2-(4-Methylphenyl)benzimidazole

Purity: 98%

Molecular weight: 208.26g/mol

Ref: 54-OR1009778