CAS 120-51-4: Benzyl benzoate

Description:Benzyl benzoate is an organic compound with the chemical formula C14H12O2, characterized by its ester functional group formed from benzyl alcohol and benzoic acid. It appears as a colorless to pale yellow liquid with a sweet, floral aroma, making it useful in the fragrance industry. Benzyl benzoate has a relatively low solubility in water but is soluble in organic solvents such as ethanol and ether. It has a moderate boiling point and a density greater than that of water. This compound is known for its applications as a solvent, plasticizer, and fixative in perfumes. Additionally, it has been utilized in the pharmaceutical industry, particularly as a topical treatment for scabies and as a potential insect repellent. While generally considered safe for use in cosmetics and food products, it can cause allergic reactions in some individuals. As with many chemicals, proper handling and safety precautions are essential to mitigate any potential risks associated with exposure.

Formula:C₁₄H₁₂O₂

InChI:InChI=1S/C14H12O2/c15-14(13-9-5-2-6-10-13)16-11-12-7-3-1-4-8-12/h1-10H,11H2

InChI key:InChIKey=SESFRYSPDFLNCH-UHFFFAOYSA-N

SMILES:O=C(OCC=1C=CC=CC1)C=2C=CC=CC2