
CAS 120-68-3
:4-[2-(4-Amino-3-methylphenyl)diazenyl]-3-methylbenzenesulfonic acid
Description:
4-[2-(4-Amino-3-methylphenyl)diazenyl]-3-methylbenzenesulfonic acid, commonly known as an azo dye, is characterized by its vibrant color and is primarily used in dyeing applications. This compound features a diazo functional group, which is responsible for its intense coloration, and a sulfonic acid group that enhances its solubility in water, making it suitable for various textile and industrial applications. The presence of amino and methyl groups in its structure contributes to its reactivity and stability. Azo dyes are known for their ability to form stable bonds with fibers, resulting in long-lasting coloration. However, some azo compounds can be subject to regulatory scrutiny due to potential health and environmental concerns, particularly regarding the release of aromatic amines upon degradation. Overall, this compound exemplifies the characteristics typical of azo dyes, including strong coloration, water solubility, and specific functional groups that influence its chemical behavior and application potential.
Formula:C14H15N3O3S
InChI:InChI=1S/C14H15N3O3S/c1-9-7-11(3-5-13(9)15)16-17-14-6-4-12(8-10(14)2)21(18,19)20/h3-8H,15H2,1-2H3,(H,18,19,20)
InChI key:InChIKey=OLDIJSAKWOOHRZ-UHFFFAOYSA-N
SMILES:N(=NC1=CC(C)=C(N)C=C1)C2=C(C)C=C(S(=O)(=O)O)C=C2
Synonyms:- 4-[2-(4-Amino-3-methylphenyl)diazenyl]-3-methylbenzenesulfonic acid
- 4-(4-Amino-3-methylphenylazo)-m-toluenesulfonic acid
- m-Toluenesulfonic acid, 4-[(4-amino-m-tolyl)azo]-
- Benzenesulfonic acid, 4-[2-(4-amino-3-methylphenyl)diazenyl]-3-methyl-
- Benzenesulfonic acid, 4-[(4-amino-3-methylphenyl)azo]-3-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Benzenesulfonic acid, 4-[2-(4-amino-3-methylphenyl)diazenyl]-3-methyl-
CAS:Formula:C14H15N3O3SMolecular weight:305.3522
