CAS 120-87-6
:9,10-Dihydroxystearic acid
Description:
9,10-Dihydroxystearic acid is a dihydroxy fatty acid derived from stearic acid, characterized by the presence of two hydroxyl (-OH) groups located at the 9th and 10th carbon positions of the long hydrocarbon chain. This compound typically appears as a white to off-white solid or waxy substance and is soluble in organic solvents but has limited solubility in water due to its hydrophobic hydrocarbon tail. It exhibits properties such as emulsification, surfactancy, and potential use as a lubricant or thickening agent in various formulations. The presence of hydroxyl groups enhances its reactivity, allowing for further chemical modifications, which can be beneficial in applications ranging from cosmetics to pharmaceuticals. Additionally, 9,10-dihydroxystearic acid can serve as a precursor for the synthesis of other chemical compounds. Its safety profile indicates low toxicity, but standard handling precautions should be observed, as with any chemical substance. Overall, its unique structure and properties make it a valuable compound in both industrial and research settings.
Formula:C18H36O4
InChI:InChI=1S/C18H36O4/c1-2-3-4-5-7-10-13-16(19)17(20)14-11-8-6-9-12-15-18(21)22/h16-17,19-20H,2-15H2,1H3,(H,21,22)
InChI key:InChIKey=VACHUYIREGFMSP-UHFFFAOYSA-N
SMILES:C(C(CCCCCCCC)O)(CCCCCCCC(O)=O)O
Synonyms:- (9S,10R)-9,10-dihydroxyoctadecanoic acid
- 9,10-Dihydroxyoctadecanoic acid
- 9,10-Dihydroxystearate
- 9,10-Dihydroxystearinsaeure
- Ai3-14192
- Ammonium 9,10-Dihydroxyoctadecanoate
- Dioxystearinsaeure
- Lithium 9,10-Dihydroxyoctadecanoate
- Nsc 60305
- Octadecanoic acid, 9,10-dihydroxy-
- Octadecanoic acid, 9,10-dihydroxy- (8CI)(9CI)
- Potassium 9,10-Dihydroxyoctadecanoate
- Sodium 9,10-Dihydroxyoctadecanoate
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
9,10-Dihydroxystearic Acid
CAS:Formula:C18H36O4Purity:97%Color and Shape:SolidMolecular weight:316.47609,10-Dihydroxyoctadecanoic acid
CAS:9,10-Dihydroxyoctadecanoic acidPurity:97%Molecular weight:316.48g/mol9,10-Dihydroxystearic acid
CAS:9,10-Dihydroxystearic acid, an oxidation derivative of oleic acid, exhibits beneficial effects on glucose tolerance and insulin sensitivity in KKAy mice.Formula:C18H36O4Color and Shape:SolidMolecular weight:316.489,10-Dihydroxystearic acid
CAS:9,10-Dihydroxystearic acid is an ester that can be found in fatty acids. It is a model system for studying the reaction mechanism of ester linkages. 9,10-Dihydroxystearic acid has been shown to have a Michaelis–Menten kinetics with respect to NADPH and cytochrome P450 enzymes. 9,10-Dihydroxystearic acid has been used as an analytical chemistry probe for distinguishing between hepg2 cells and other cell types. 9,10-Dihydroxystearic acid also has magnetic resonance spectroscopy properties that make it an excellent probe for structural analysis.
Formula:C18H36O4Purity:Min. 95%Color and Shape:White PowderMolecular weight:316.48 g/mol9,10-Dihydroxystearic Acid
CAS:Controlled ProductFormula:C18H36O4Color and Shape:NeatMolecular weight:316.48






