CAS 1200-05-1
:4-AMINOMETHYLPHENYLACETIC ACID
Description:
4-Aminomethylphenylacetic acid, also known by its CAS number 1200-05-1, is an organic compound characterized by the presence of an amino group and a phenylacetic acid moiety. This compound typically appears as a white to off-white solid and is soluble in polar solvents such as water and alcohols, owing to its functional groups. The amino group (-NH2) contributes to its basicity, while the carboxylic acid group (-COOH) imparts acidic properties, allowing it to participate in various chemical reactions, including amide formation and esterification. Its structure suggests potential applications in pharmaceuticals, particularly in the synthesis of biologically active compounds. Additionally, the presence of the phenyl ring may enhance its interaction with biological targets, making it of interest in medicinal chemistry. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken due to potential toxicity or reactivity.
Formula:C9H11NO2
InChI:InChI=1/C9H11NO2/c10-6-8-3-1-7(2-4-8)5-9(11)12/h1-4H,5-6,10H2,(H,11,12)
SMILES:c1cc(ccc1CC(=O)O)CN
Synonyms:- 2-(4-(Aminomethyl)Phenyl)Acetic Acid
- 4-(Aminomethyl)phenylacetic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
4-Aminomethylphenylacetic acid
CAS:Formula:C9H11NO2Purity:97%Color and Shape:SolidMolecular weight:165.18914-Aminomethylphenylacetic acid
CAS:Formula:C9H11NO2Purity:97%Color and Shape:No data available.Molecular weight:165.1924-Aminomethylphenylacetic acid
CAS:4-Aminomethylphenylacetic acid is a nonsteroidal anti-inflammatory drug that is used to treat inflammation and pain. It belongs to the class of peptidomimetics, which are compounds that mimic the structure of a natural biological molecule. 4-Aminomethylphenylacetic acid has an analog with a lactam ring at position 3, which is not present in other NSAIDs. This structural difference may contribute to its high stability and low reactivity. 4-Aminomethylphenylacetic acid has been shown to exhibit antiviral activity against viruses such as HIV or Hepatitis C virus by inhibiting viral replication.
Formula:C9H11NO2·HClPurity:Min. 95%Molecular weight:201.65 g/molRef: 3D-FA51232
Discontinued product


