CAS 1200-26-6
:3,3,5,5-Tetramethyl-2,6-piperidinedione
Description:
3,3,5,5-Tetramethyl-2,6-piperidinedione, commonly referred to as a diketone, is an organic compound characterized by its piperidine ring structure, which features two carbonyl (C=O) groups at the 2 and 6 positions. This compound is notable for its bulky tetramethyl substituents at the 3 and 5 positions, which contribute to its steric hindrance and influence its reactivity and solubility. It is typically a solid at room temperature and is soluble in organic solvents. The presence of the carbonyl groups makes it a potential candidate for various chemical reactions, including condensation and cyclization. Additionally, it can act as a ligand in coordination chemistry due to its ability to donate electron pairs. Its applications span across fields such as organic synthesis, pharmaceuticals, and materials science. Safety data indicates that it should be handled with care, as it may pose health risks upon exposure. Overall, 3,3,5,5-Tetramethyl-2,6-piperidinedione is a versatile compound with significant chemical properties and potential applications.
Formula:C9H15NO2
InChI:InChI=1S/C9H15NO2/c1-8(2)5-9(3,4)7(12)10-6(8)11/h5H2,1-4H3,(H,10,11,12)
InChI key:InChIKey=ONDLMOXZQBYACX-UHFFFAOYSA-N
SMILES:CC1(C)CC(C)(C)C(=O)NC1=O
Synonyms:- 3,3,5,5-Tetramethyl-2,6-piperidinedione
- 2,6-Piperidinedione, 3,3,5,5-tetramethyl-
- 3,3,5,5-Tetramethylglutarimide
- Glutarimide, 2,2,4,4-tetramethyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
