
CAS 1200-70-0
:Dihydro-3-hydroxy-3-phenyl-2(3H)-furanone
Description:
Dihydro-3-hydroxy-3-phenyl-2(3H)-furanone, with the CAS number 1200-70-0, is an organic compound characterized by its furanone structure, which features a five-membered lactone ring. This compound typically exhibits a pale yellow to colorless appearance and is known for its sweet, fruity aroma, often associated with flavors in food and fragrance applications. It has a hydroxyl group (-OH) and a phenyl group attached to the furanone ring, contributing to its chemical reactivity and potential interactions in various chemical environments. Dihydro-3-hydroxy-3-phenyl-2(3H)-furanone is soluble in organic solvents and may have limited solubility in water, reflecting its hydrophobic characteristics. Its applications span across the food industry as a flavoring agent and in the fragrance industry due to its pleasant scent. Additionally, it may serve as a precursor in organic synthesis, highlighting its versatility in chemical reactions. Safety data should be consulted for handling and usage, as with all chemical substances.
Formula:C10H10O3
InChI:InChI=1S/C10H10O3/c11-9-10(12,6-7-13-9)8-4-2-1-3-5-8/h1-5,12H,6-7H2
InChI key:InChIKey=MSRQHIKEISJDJI-UHFFFAOYSA-N
SMILES:OC1(C(=O)OCC1)C2=CC=CC=C2
Synonyms:- Dihydro-3-hydroxy-3-phenyl-2(3H)-furanone
- 3-Hydroxy-3-phenyldihydrofuran-2(3H)-one
- 2(3H)-Furanone, dihydro-3-hydroxy-3-phenyl-
- Butyric acid, 2,4-dihydroxy-2-phenyl-, γ-lactone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
